cbw7behmyr cbw7behmyr

11-02-2022
Physics

contestada

what would the mass be of an object that was moving at a velocity of 35 m/s and has a kinetic energy of 500j be?

Respuesta :

zsm2800 zsm2800

21-02-2022

Answer:

0.816 kg

Explanation:

[tex]E_k=\frac{1}{2}mv^{2}\\[/tex]

so [tex]m=\frac{2E_k}{v^2}=\frac{2\times500}{35^2}=0.816 kg[/tex]

Answer Link

Otras preguntas

I need help on this problem.

For every kilometer that a parcel of dry air is elevated adiabatically what approximate temperature decreases does it experience? 1 3 5 10

-6g + 36 = 12 Help please

What is the cause of Slavery and the effect for racism. For Imperialism

How does a molecule of water move between the hydrosphere, geosphere, and biosphere

This is the belief that the ultimate power of the government rests on the will of the people themselves

simplify the expression using sum or difference identities cos(12)cos(-3)-sin(12)sin(-3)

Nutrition Questions: 1. Susie's protein intake (11% of total Calories) is within the AMDR for protein (10% to 35% of total Calories). Is Susie eating enough pro

When was the battle of Grunwald???

What is the Kinetic Energy of an object with a mass of 360 kilograms that is traveling at 23 meters per second?