dstyles29 dstyles29
  • 12-06-2020
  • English
contestada

Which of the six traits of writing refers to the way sentences are written and flow together to tell a story?

Respuesta :

ellatrible ellatrible
  • 24-06-2020

Answer:Sentence Fluency

Explanation:

Answer Link

Otras preguntas

Which of the following might prevent a wound from healing?        A. Cleaning   B. Exercise   C. Poor sleeping habits   D. Dehydration
What type of error in meiosis causes Down syndrome
Determine whether the sequence converges or diverges. If it converges, give the limit. 108, -18, 3, negative one divided by two, ...
What is the rate constant of a first-order reaction that takes 5.50 minutes for the reactant concentration to drop to half of its initial value?
What is the LCM of x^2+4x, x^2
What is the area of the top of the pie? Round to the nearest tenth at the end real world app:about how much foil will you need to use to cover it
How does sound travel through waves?
Show that cos(A+45)=cos45(cosA-sinA)
what is greater 5/8 or 9/14
One main reason for the fall of the Mongol Empire was A. the spread of diseases brought by Europeans. B. military invasions by Muslim armies. C. a weakene