popalley09 popalley09
  • 13-02-2020
  • Physics
contestada

why are elements in group one reactive​

Respuesta :

amygeez amygeez
  • 13-02-2020

Answer:

Elements in the same group of the periodic table have the same number of valence electrons. These are the electrons in their outer energy level that can be involved in chemical reactions. ... All the elements in group 1 have just one valence electron. This makes them very reactive.

Answer Link

Otras preguntas

How to you solve for "infinitely many solutions"? Also, how do you solve for "no solutions"? How would it differ from "one solution"?
What role did drama and music play in the lives of the ancient Greeks? How were the two forms interrelated?
Which rational number is equivalent to /0.36?
Pls help!! how does george washington sell the idea of the new constitution?
0=>p-10 what does this mean
Write an explicit formula for an, the nth term of the sequence 33, 30, 27
Planes A and B intersect. Vertical plane B intersects horizontal plane A at line E D. Line C D is on plane A. Which describes the intersection of planes A and
If a company receives an average of average of 3 calls per 5minute period in a working day, the probability of receiving no calls during a randomly selected 5 m
IUPAC NAME FOR:CH2(OH)-CH2-CH(C2H5)-OH
Using the verbs ser and estar in the present tense what qualities do you think make a good friend