caitlin51 caitlin51

11-03-2016
History

contestada

Why do u think some of the slaveholding states decided not to join the confederacy

Respuesta :

HistoryGuy HistoryGuy

12-03-2016

One of the main reasons why some of the slaveholding states decided not to join the confederacy is because although they supported slavery, they were also patriotic, and felt that the Union needed to stay together no matter what the cost.

Answer Link

Otras preguntas

The cost to produce a table, y, is two times the cost to produce a chair, x.

The price of a computer component is decreasing at a rate of 11% per year. State whether this decrease is linear or exponential. If the component costs $80 t

the selling price of a watch is Rs. 4000. If the watch is sold at 20% discount on the market price .Find he market price of the watch

What would be needed to make the double v campaign more successful

What are characteristics of minerals? Check all that apply. Solid Organic Man-made Crystal structure Definite chemical composition

What is 6 wholes - 3 2/5

do chromosomes make up genes?

simplify the expression using sum or difference identities cos(12)cos(-3)-sin(12)sin(-3)

Frank got 24 out of 96 correct in his test. What fraction of the marks did he get correct? Give your answer in its simplest form

a fishbowl shaped like a sphere is filled with water. The fishbowl has a diameter of 16 inches. Which measurement is closest to the volume of water in the fishb