bruno29bears bruno29bears

10-06-2018
Mathematics

contestada

How many degrees in the angles of a tridecagon?

Respuesta :

Moblitz Moblitz

10-06-2018

Each angle is approximately 152.308 degrees.

Answer Link

Otras preguntas

simplify the expression using sum or difference identities cos(12)cos(-3)-sin(12)sin(-3)

This is the belief that the ultimate power of the government rests on the will of the people themselves

How to you turn a file into JPEG step by step

What did Johnson accuse the North Vietnamese of?

NEED HELP ASAP PLEASE !!!!!!!!!!!!!!!!!!! Find the slope of a line parallel to the line through the given points. P(-2, 4), Q(6, -2) 4/3 3/4 -3/4 Find the slope

chemical term for Bromine at room temperature

Read the sentences and the writer’s revisions. Original: My mother dusts the house from the moment she wakes up. She is concerned about the dust collecting on h

wind energy gaining support as a possible energy source for people. what is the source of the energy that generated wind?

How did this passage support the Feudal concept of loyalty?) His description supported the Feudal concept of loyalty because) Expended thesis:) Aim: How did Man

The following table represents the total cost, in dollars (y) to join a gym for x number of months. The cost includes a one-time joining fee of $10. Does the d