albertallwell3 albertallwell3

12-01-2021
Mathematics

contestada

b.
Find the compound interest on N 8000, 00 for 3 years at 5% per annum

Respuesta :

shortcake5603 shortcake5603

12-01-2021

Answer:

926,100

Step-by-step explanation:

you will have earned in 126,100 in interest

Answer Link

Otras preguntas

How did the Federalists New England react to the Louisiana Purchase?

What equation has a constant of proportionality equal to 4?

If f(x) = x^2 + 9x, find f(a - 4)

Show that cos(A+45)=cos45(cosA-sinA)

Which of the following sentences could take the place of: José Luís lanzó el balón a nosotros.

I NEED HELP ASAP Kimberley wants to plot a graph to show the prices of different numbers of skateboards. She has to plot the following points: (1, 49.99), (2, 9

How did Shiloh end the thought that the war was going to be a quick one?

find a cofunction with the same value as tan pi/7

Who was John Hansen?

what is the effects of the committee of correspondence